C20H26N4O6S — CID 4795337
2-[3-(diethylsulfamoyl)-4-methylanilino]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 4795337) has the molecular formula C20H26N4O6S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-[3-(diethylsulfamoyl)-4-methylanilino]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[3-(diethylsulfamoyl)-4-methylanilino]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4795337 |
| Molecular Formula | C20H26N4O6S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[3-(diethylsulfamoyl)-4-methylanilino]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NCC(=O)Nc2ccc(OC)cc2[N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C20H26N4O6S/c1-5-23(6-2)31(28,29)19-11-15(8-7-14(19)3)21-13-20(25)22-17-10-9-16(30-4)12-18(17)24(26)27/h7-12,21H,5-6,13H2,1-4H3,(H,22,25) |
| InChIKey | GSTHUZDJPSJROE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|