C24H25N3O6S — CID 22303867
N-(3,4-dimethylphenyl)-2-[4-methoxy-2-(4-methyl-3-nitrophenyl)sulfonylanilino]acetamide (PubChem CID 22303867) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[4-methoxy-2-(4-methyl-3-nitrophenyl)sulfonylanilino]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[4-methoxy-2-(4-methyl-3-nitrophenyl)sulfonylanilino]acetamide |
|---|---|
| PubChem CID | 22303867 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[4-methoxy-2-(4-methyl-3-nitrophenyl)sulfonylanilino]acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(C)c(C)c2)c(S(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H25N3O6S/c1-15-5-7-18(11-17(15)3)26-24(28)14-25-21-10-8-19(33-4)12-23(21)34(31,32)20-9-6-16(2)22(13-20)27(29)30/h5-13,25H,14H2,1-4H3,(H,26,28) |
| InChIKey | VBCLKWZJCVSDLK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|