C16H19Cl2N3O — CID 4806223
N-(1-cyanocyclopentyl)-2-[1-(2,4-dichlorophenyl)ethylamino]acetamide (PubChem CID 4806223) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-[1-(2,4-dichlorophenyl)ethylamino]acetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-[1-(2,4-dichlorophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 4806223 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-[1-(2,4-dichlorophenyl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)NC1(C#N)CCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O/c1-11(13-5-4-12(17)8-14(13)18)20-9-15(22)21-16(10-19)6-2-3-7-16/h4-5,8,11,20H,2-3,6-7,9H2,1H3,(H,21,22) |
| InChIKey | JCXSJKYCUNUKDB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |