C23H23N3O5S2 — CID 4816052
methyl 4-[[5-[[2-(2-methoxy-4-prop-1-enylphenoxy)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate (PubChem CID 4816052) has the molecular formula C23H23N3O5S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is methyl 4-[[5-[[2-(2-methoxy-4-prop-1-enylphenoxy)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[[2-(2-methoxy-4-prop-1-enylphenoxy)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 4816052 |
| Molecular Formula | C23H23N3O5S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | methyl 4-[[5-[[2-(2-methoxy-4-prop-1-enylphenoxy)acetyl]amino]-1,3,4-thiadiazol-2-yl]sulfanylmethyl]benzoate |
| SMILES | CC=Cc1ccc(OCC(=O)Nc2nnc(SCc3ccc(C(=O)OC)cc3)s2)c(OC)c1 |
| InChI | InChI=1S/C23H23N3O5S2/c1-4-5-15-8-11-18(19(12-15)29-2)31-13-20(27)24-22-25-26-23(33-22)32-14-16-6-9-17(10-7-16)21(28)30-3/h4-12H,13-14H2,1-3H3,(H,24,25,27) |
| InChIKey | IEQWVZUWYHPKJA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|