C19H22ClN3O6S — CID 4832794
(4-amino-3-cyano-2-oxopent-3-enyl) 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate (PubChem CID 4832794) has the molecular formula C19H22ClN3O6S and a molecular weight of 455.92 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 4832794 |
| Molecular Formula | C19H22ClN3O6S |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 4-chloro-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzoate |
| SMILES | CC(N)=C(C#N)C(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C19H22ClN3O6S/c1-11-8-23(9-12(2)29-11)30(26,27)18-6-14(4-5-16(18)20)19(25)28-10-17(24)15(7-21)13(3)22/h4-6,11-12H,8-10,22H2,1-3H3 |
| InChIKey | LANCGODCGYZJLX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|