C21H20N4O5S — CID 4836309
4-methoxy-6-methyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-amine (PubChem CID 4836309) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is 4-methoxy-6-methyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-amine.
| Compound Name | 4-methoxy-6-methyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
|---|---|
| PubChem CID | 4836309 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-methoxy-6-methyl-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-amine |
| SMILES | COc1c2c(cc3c1C(Nc1nc(-c4cccc([N+](=O)[O-])c4)cs1)N(C)CC3)OCO2 |
| InChI | InChI=1S/C21H20N4O5S/c1-24-7-6-13-9-16-18(30-11-29-16)19(28-2)17(13)20(24)23-21-22-15(10-31-21)12-4-3-5-14(8-12)25(26)27/h3-5,8-10,20H,6-7,11H2,1-2H3,(H,22,23) |
| InChIKey | UDMLTQFJVQKENF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|