C19H14N4O4S2 — CID 4840097
2-[[3-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylamino]benzoic acid (PubChem CID 4840097) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-[[3-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[3-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 4840097 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2-[[3-(thieno[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cccc(Nc2ncnc3sccc23)c1 |
| InChI | InChI=1S/C19H14N4O4S2/c24-19(25)14-6-1-2-7-16(14)23-29(26,27)13-5-3-4-12(10-13)22-17-15-8-9-28-18(15)21-11-20-17/h1-11,23H,(H,24,25)(H,20,21,22) |
| InChIKey | ICKONCHVQDRZPD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |