C24H26N4O5S — CID 4843575
2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 4843575) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4843575 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]amino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccco1)c1ccccc1NCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N4O5S/c29-23(27-12-14-28(15-13-27)34(31,32)20-8-2-1-3-9-20)18-25-22-11-5-4-10-21(22)24(30)26-17-19-7-6-16-33-19/h1-11,16,25H,12-15,17-18H2,(H,26,30) |
| InChIKey | SPNILBPCIUVMHQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |