C23H17ClF3N5O4S — CID 4844014
N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]anilino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide (PubChem CID 4844014) has the molecular formula C23H17ClF3N5O4S and a molecular weight of 551.93 g/mol. Its IUPAC name is N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]anilino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide.
| Compound Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]anilino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 4844014 |
| Molecular Formula | C23H17ClF3N5O4S |
| Molecular Weight | 551.93 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | N-[2-chloro-5-[(2-methoxyphenyl)sulfamoyl]anilino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(Cl)c(NN=C(C#N)C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H17ClF3N5O4S/c1-36-21-8-3-2-7-18(21)32-37(34,35)16-9-10-17(24)19(12-16)30-31-20(13-28)22(33)29-15-6-4-5-14(11-15)23(25,26)27/h2-12,30,32H,1H3,(H,29,33) |
| InChIKey | LMZVQLXSZBVKPZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.93 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|