C18H16ClN3O3S2 — CID 4845389
[2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 4845389) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 4845389 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | [2-(2,1,3-benzothiadiazol-4-ylamino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | O=C(COC(=O)CCCSc1ccc(Cl)cc1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C18H16ClN3O3S2/c19-12-6-8-13(9-7-12)26-10-2-5-17(24)25-11-16(23)20-14-3-1-4-15-18(14)22-27-21-15/h1,3-4,6-9H,2,5,10-11H2,(H,20,23) |
| InChIKey | VYUPPMCASDMFLS-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|