C26H27ClN2O4 — CID 4846053
N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-3-chloroadamantane-1-carboxamide (PubChem CID 4846053) has the molecular formula C26H27ClN2O4 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-3-chloroadamantane-1-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-3-chloroadamantane-1-carboxamide |
|---|---|
| PubChem CID | 4846053 |
| Molecular Formula | C26H27ClN2O4 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylmethylcarbamoyl)phenyl]-3-chloroadamantane-1-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccccc1NC(=O)C12CC3CC(CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C26H27ClN2O4/c27-26-11-17-7-18(12-26)10-25(9-17,14-26)24(31)29-20-4-2-1-3-19(20)23(30)28-13-16-5-6-21-22(8-16)33-15-32-21/h1-6,8,17-18H,7,9-15H2,(H,28,30)(H,29,31) |
| InChIKey | HWNMJHNXMXRGIK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|