C17H18ClFN2O4S2 — CID 4851888
N-tert-butyl-4-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-nitrobenzenesulfonamide (PubChem CID 4851888) has the molecular formula C17H18ClFN2O4S2 and a molecular weight of 432.93 g/mol. Its IUPAC name is N-tert-butyl-4-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-tert-butyl-4-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4851888 |
| Molecular Formula | C17H18ClFN2O4S2 |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | N-tert-butyl-4-[(2-chloro-6-fluorophenyl)methylsulfanyl]-3-nitrobenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(SCc2c(F)cccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H18ClFN2O4S2/c1-17(2,3)20-27(24,25)11-7-8-16(15(9-11)21(22)23)26-10-12-13(18)5-4-6-14(12)19/h4-9,20H,10H2,1-3H3 |
| InChIKey | JXTBAEDNAZPKGX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|