C26H22O5 — CID 4861266
6-[(3-methoxyphenyl)methoxy]-2-[3-(2-methoxyphenyl)prop-2-enylidene]-1-benzofuran-3-one (PubChem CID 4861266) has the molecular formula C26H22O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is 6-[(3-methoxyphenyl)methoxy]-2-[3-(2-methoxyphenyl)prop-2-enylidene]-1-benzofuran-3-one.
| Compound Name | 6-[(3-methoxyphenyl)methoxy]-2-[3-(2-methoxyphenyl)prop-2-enylidene]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 4861266 |
| Molecular Formula | C26H22O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 6-[(3-methoxyphenyl)methoxy]-2-[3-(2-methoxyphenyl)prop-2-enylidene]-1-benzofuran-3-one |
| SMILES | COc1cccc(COc2ccc3c(c2)OC(=CC=Cc2ccccc2OC)C3=O)c1 |
| InChI | InChI=1S/C26H22O5/c1-28-20-10-5-7-18(15-20)17-30-21-13-14-22-25(16-21)31-24(26(22)27)12-6-9-19-8-3-4-11-23(19)29-2/h3-16H,17H2,1-2H3 |
| InChIKey | TYNHIUVZXBJHOD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|