C16H18ClF2N3O2 — CID 48659341
N-[2-(3-chlorophenoxy)ethyl]-2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetamide (PubChem CID 48659341) has the molecular formula C16H18ClF2N3O2 and a molecular weight of 357.79 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 48659341 |
| Molecular Formula | C16H18ClF2N3O2 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-2-[1-(difluoromethyl)-3,5-dimethylpyrazol-4-yl]acetamide |
| SMILES | Cc1nn(C(F)F)c(C)c1CC(=O)NCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClF2N3O2/c1-10-14(11(2)22(21-10)16(18)19)9-15(23)20-6-7-24-13-5-3-4-12(17)8-13/h3-5,8,16H,6-7,9H2,1-2H3,(H,20,23) |
| InChIKey | WCSCHCLMURILCE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|