About cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate)
cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) (PubChem CID 4868195) has the molecular formula C10H18CoN8O2S2
and a molecular weight of 405.38 g/mol. Its IUPAC name is cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate).
Molecular Properties
| Compound Name | cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) |
| PubChem CID | 4868195 |
| Molecular Formula | C10H18CoN8O2S2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) |
| SMILES | CC(N=O)=C(C)NN=C(N)[S-].CC(N=O)=C(C)NN=C(N)[S-].[Co+2] |
| InChI | InChI=1S/2C5H10N4OS.Co/c2*1-3(4(2)9-10)7-8-5(6)11;/h2*7H,1-2H3,(H3,6,8,11);/q;;+2/p-2 |
| InChIKey | WZSKXTILZZUOSR-UHFFFAOYSA-L |
| XLogP | 0.74 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate)?
The IUPAC name of cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) (CID 4868195) is cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate).
What is the SMILES notation for cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate)?
The canonical SMILES for cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) is CC(N=O)=C(C)NN=C(N)[S-].CC(N=O)=C(C)NN=C(N)[S-].[Co+2].
What is the InChIKey of cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate)?
The InChIKey is WZSKXTILZZUOSR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10N4OS.Co/c2*1-3(4(2)9-10)7-8-5(6)11;/h2*7H,1-2H3,(H3,6,8,11);/q;;+2/p-2.
What are the key properties of cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate)?
cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) has a molecular weight of 405.38 g/mol, XLogP of 0.74, 6 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(N'-(3-nitrosobut-2-en-2-ylamino)carbamimidothioate) is sourced from PubChem (CID 4868195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).