C4H6N2O2 — CID 24867599
(Z)-2,3-dinitrosobut-2-ene (PubChem CID 24867599) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is (Z)-2,3-dinitrosobut-2-ene.
| Compound Name | (Z)-2,3-dinitrosobut-2-ene |
|---|---|
| PubChem CID | 24867599 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | (Z)-2,3-dinitrosobut-2-ene |
| SMILES | C/C(N=O)=C(\C)N=O |
| InChI | InChI=1S/C4H6N2O2/c1-3(5-7)4(2)6-8/h1-2H3/b4-3- |
| InChIKey | ZWLBYOQTVLMRFT-ARJAWSKDSA-N |
| XLogP | 1.77 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |