C15H21NO — CID 88943770
(3E,6E,8E)-4,6,7,8-tetramethyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraene (PubChem CID 88943770) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (3E,6E,8E)-4,6,7,8-tetramethyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraene.
| Compound Name | (3E,6E,8E)-4,6,7,8-tetramethyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 88943770 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (3E,6E,8E)-4,6,7,8-tetramethyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraene |
| SMILES | C=C/C=C(\C)C(=C)/C(C)=C(C)\C(C)=C(/C)N=O |
| InChI | InChI=1S/C15H21NO/c1-8-9-10(2)11(3)12(4)13(5)14(6)15(7)16-17/h8-9H,1,3H2,2,4-7H3/b10-9+,13-12+,15-14+ |
| InChIKey | VEKAEJYXXRSJFY-NTZSSEQASA-N |
| XLogP | 5.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|