C3H3Cl2NO — CID 12727294
1,1-dichloro-2-nitrosoprop-1-ene (PubChem CID 12727294) has the molecular formula C3H3Cl2NO and a molecular weight of 139.97 g/mol. Its IUPAC name is 1,1-dichloro-2-nitrosoprop-1-ene.
| Compound Name | 1,1-dichloro-2-nitrosoprop-1-ene |
|---|---|
| PubChem CID | 12727294 |
| Molecular Formula | C3H3Cl2NO |
| Molecular Weight | 139.97 g/mol |
| Exact Mass | 138.96 |
| IUPAC Name | 1,1-dichloro-2-nitrosoprop-1-ene |
| SMILES | CC(N=O)=C(Cl)Cl |
| InChI | InChI=1S/C3H3Cl2NO/c1-2(6-7)3(4)5/h1H3 |
| InChIKey | YSKBPIMKJCESSG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.97 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |