C19H18N3O2S3+ — CID 4872281
3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-ium-2-amine (PubChem CID 4872281) has the molecular formula C19H18N3O2S3+ and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-ium-2-amine.
| Compound Name | 3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 4872281 |
| Molecular Formula | C19H18N3O2S3+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-ium-2-amine |
| SMILES | Cc1ccc2nc(-c3ccc([N+]4=C(N)SC5CS(=O)(=O)CC54)cc3)sc2c1 |
| InChI | InChI=1S/C19H17N3O2S3/c1-11-2-7-14-16(8-11)25-18(21-14)12-3-5-13(6-4-12)22-15-9-27(23,24)10-17(15)26-19(22)20/h2-8,15,17,20H,9-10H2,1H3/p+1 |
| InChIKey | ZNMWSWKDSXGIKF-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|