C19H17N3O2S3 — CID 6984492
(3aS,6aR)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 6984492) has the molecular formula C19H17N3O2S3 and a molecular weight of 415.57 g/mol. Its IUPAC name is (3aS,6aR)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aS,6aR)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 6984492 |
| Molecular Formula | C19H17N3O2S3 |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | (3aS,6aR)-3-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(-c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C19H17N3O2S3/c1-11-2-7-14-16(8-11)25-18(21-14)12-3-5-13(6-4-12)22-15-9-27(23,24)10-17(15)26-19(22)20/h2-8,15,17,20H,9-10H2,1H3/b20-19-/t15-,17-/m0/s1 |
| InChIKey | ZNMWSWKDSXGIKF-WXOYBGPJSA-N |
| XLogP | 3.93 |
| TPSA | 74.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|