C21H19N3O5 — CID 4878165
methyl 2-[1-[2-(furan-2-yl)quinoline-4-carbonyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4878165) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is methyl 2-[1-[2-(furan-2-yl)quinoline-4-carbonyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(furan-2-yl)quinoline-4-carbonyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4878165 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | methyl 2-[1-[2-(furan-2-yl)quinoline-4-carbonyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1C(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C21H19N3O5/c1-28-19(25)12-17-20(26)22-8-9-24(17)21(27)14-11-16(18-7-4-10-29-18)23-15-6-3-2-5-13(14)15/h2-7,10-11,17H,8-9,12H2,1H3,(H,22,26) |
| InChIKey | QQJQIQXGTDKKHR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |