C26H23N3O4 — CID 55969264
1-[2-(furan-2-yl)quinoline-4-carbonyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 55969264) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)quinoline-4-carbonyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(furan-2-yl)quinoline-4-carbonyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55969264 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[2-(furan-2-yl)quinoline-4-carbonyl]-N-(4-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN2C(=O)c2cc(-c3ccco3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H23N3O4/c1-32-18-12-10-17(11-13-18)27-25(30)23-8-4-14-29(23)26(31)20-16-22(24-9-5-15-33-24)28-21-7-3-2-6-19(20)21/h2-3,5-7,9-13,15-16,23H,4,8,14H2,1H3,(H,27,30) |
| InChIKey | ZYOPWVIKSVNSGS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |