C20H20BrClN2O4S — CID 4881951
1-[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 4881951) has the molecular formula C20H20BrClN2O4S and a molecular weight of 499.81 g/mol. Its IUPAC name is 1-[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4881951 |
| Molecular Formula | C20H20BrClN2O4S |
| Molecular Weight | 499.81 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | 1-[4-(4-bromo-2-chlorophenyl)sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1C=CC(=O)N1CCN(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C20H20BrClN2O4S/c1-28-18-5-3-2-4-15(18)6-9-20(25)23-10-12-24(13-11-23)29(26,27)19-8-7-16(21)14-17(19)22/h2-9,14H,10-13H2,1H3 |
| InChIKey | QNGSHDBQBOTKLU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.81 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|