C21H20ClF3N2O4S — CID 55341587
(E)-1-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 55341587) has the molecular formula C21H20ClF3N2O4S and a molecular weight of 488.92 g/mol. Its IUPAC name is (E)-1-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55341587 |
| Molecular Formula | C21H20ClF3N2O4S |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | (E)-1-[4-[2-chloro-5-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1/C=C/C(=O)N1CCN(S(=O)(=O)c2cc(C(F)(F)F)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H20ClF3N2O4S/c1-31-18-5-3-2-4-15(18)6-9-20(28)26-10-12-27(13-11-26)32(29,30)19-14-16(21(23,24)25)7-8-17(19)22/h2-9,14H,10-13H2,1H3/b9-6+ |
| InChIKey | NVXUFHAHGJTVGW-RMKNXTFCSA-N |
| XLogP | 3.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|