C16H19F3N2O3S — CID 48868130
2-(3-methoxyphenyl)-1-[4-[2-(trifluoromethylsulfanyl)acetyl]piperazin-1-yl]ethanone (PubChem CID 48868130) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-[4-[2-(trifluoromethylsulfanyl)acetyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3-methoxyphenyl)-1-[4-[2-(trifluoromethylsulfanyl)acetyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 48868130 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-[4-[2-(trifluoromethylsulfanyl)acetyl]piperazin-1-yl]ethanone |
| SMILES | COc1cccc(CC(=O)N2CCN(C(=O)CSC(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C16H19F3N2O3S/c1-24-13-4-2-3-12(9-13)10-14(22)20-5-7-21(8-6-20)15(23)11-25-16(17,18)19/h2-4,9H,5-8,10-11H2,1H3 |
| InChIKey | RMPNJMYHRURSCI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |