C18H18N2O5S3 — CID 4893457
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide (PubChem CID 4893457) has the molecular formula C18H18N2O5S3 and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
|---|---|
| PubChem CID | 4893457 |
| Molecular Formula | C18H18N2O5S3 |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.04 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-4-[5-[3-(furan-2-yl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=CC=Cc2ccco2)SC1=S)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C18H18N2O5S3/c21-16(19-13-8-11-28(23,24)12-13)7-2-9-20-17(22)15(27-18(20)26)6-1-4-14-5-3-10-25-14/h1,3-6,8,10-11,13H,2,7,9,12H2,(H,19,21) |
| InChIKey | MAVWEJDUOFGKAA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|