C11H11ClN4S2 — CID 4905309
1-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-ethylthiourea (PubChem CID 4905309) has the molecular formula C11H11ClN4S2 and a molecular weight of 298.82 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-ethylthiourea.
| Compound Name | 1-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-ethylthiourea |
|---|---|
| PubChem CID | 4905309 |
| Molecular Formula | C11H11ClN4S2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 1-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-1-ethylthiourea |
| SMILES | CCN(C(N)=S)c1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C11H11ClN4S2/c1-2-16(10(13)17)11-15-14-9(18-11)7-5-3-4-6-8(7)12/h3-6H,2H2,1H3,(H2,13,17) |
| InChIKey | LSTKMVIPRBDGPO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|