C20H26N4O2S — CID 4907058
6-cyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 4907058) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-cyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-cyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4907058 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 6-cyclohexyl-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(CCc2ccc(O)cc2)c2c1CN(C1CCCCC1)CN2 |
| InChI | InChI=1S/C20H26N4O2S/c25-16-8-6-14(7-9-16)10-11-24-18-17(19(26)22-20(24)27)12-23(13-21-18)15-4-2-1-3-5-15/h6-9,15,21,25H,1-5,10-13H2,(H,22,26,27) |
| InChIKey | RKQJMUXWSCAGMG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|