C21H13NO5S — CID 4910820
N-[3-(1,3-benzodioxol-5-yl)-4-oxothiochromen-2-yl]furan-2-carboxamide (PubChem CID 4910820) has the molecular formula C21H13NO5S and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)-4-oxothiochromen-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)-4-oxothiochromen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4910820 |
| Molecular Formula | C21H13NO5S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)-4-oxothiochromen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1sc2ccccc2c(=O)c1-c1ccc2c(c1)OCO2)c1ccco1 |
| InChI | InChI=1S/C21H13NO5S/c23-19-13-4-1-2-6-17(13)28-21(22-20(24)15-5-3-9-25-15)18(19)12-7-8-14-16(10-12)27-11-26-14/h1-10H,11H2,(H,22,24) |
| InChIKey | LZZQSDSULDFQKJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |