C14H13NO2S — CID 4912821
6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 4912821) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 4912821 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H13NO2S/c16-14(17)10-6-2-1-5-9(10)13-15-11-7-3-4-8-12(11)18-13/h1-4,7-10H,5-6H2,(H,16,17) |
| InChIKey | WWZWHMKDOILESF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|