C14H12N2O3S — CID 4916161
5-(3,5-dimethoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 4916161) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(3,5-dimethoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 4916161 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | COc1cc(OC)cc(-c2nc(-c3cccs3)no2)c1 |
| InChI | InChI=1S/C14H12N2O3S/c1-17-10-6-9(7-11(8-10)18-2)14-15-13(16-19-14)12-4-3-5-20-12/h3-8H,1-2H3 |
| InChIKey | KNDWWUFSFAEPFH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |