C22H17N3O4 — CID 4916739
18-(4-hydroxy-3-methoxyphenyl)-11,13,15-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17)-hexaene-14,16-dione (PubChem CID 4916739) has the molecular formula C22H17N3O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 18-(4-hydroxy-3-methoxyphenyl)-11,13,15-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17)-hexaene-14,16-dione.
| Compound Name | 18-(4-hydroxy-3-methoxyphenyl)-11,13,15-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17)-hexaene-14,16-dione |
|---|---|
| PubChem CID | 4916739 |
| Molecular Formula | C22H17N3O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 18-(4-hydroxy-3-methoxyphenyl)-11,13,15-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,8,12(17)-hexaene-14,16-dione |
| SMILES | COc1cc(C2c3c([nH]c(=O)[nH]c3=O)Nc3ccc4ccccc4c32)ccc1O |
| InChI | InChI=1S/C22H17N3O4/c1-29-16-10-12(7-9-15(16)26)17-18-13-5-3-2-4-11(13)6-8-14(18)23-20-19(17)21(27)25-22(28)24-20/h2-10,17,26H,1H3,(H3,23,24,25,27,28) |
| InChIKey | YGMSKOMEBFTKMK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |