C24H30NO2+ — CID 4919371
1,6-diphenyl-2-(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione (PubChem CID 4919371) has the molecular formula C24H30NO2+ and a molecular weight of 364.51 g/mol. Its IUPAC name is 1,6-diphenyl-2-(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione.
| Compound Name | 1,6-diphenyl-2-(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione |
|---|---|
| PubChem CID | 4919371 |
| Molecular Formula | C24H30NO2+ |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1,6-diphenyl-2-(piperidin-1-ium-1-ylmethyl)hexane-1,6-dione |
| SMILES | O=C(CCCC(C[NH+]1CCCCC1)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c26-23(20-11-4-1-5-12-20)16-10-15-22(19-25-17-8-3-9-18-25)24(27)21-13-6-2-7-14-21/h1-2,4-7,11-14,22H,3,8-10,15-19H2/p+1 |
| InChIKey | HGLNZILSMAXULC-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 38.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |