C17H24NO3+ — CID 4921181
2,6-bis(furan-2-yl)-4-methyl-3-propylpiperidin-1-ium-4-ol (PubChem CID 4921181) has the molecular formula C17H24NO3+ and a molecular weight of 290.38 g/mol. Its IUPAC name is 2,6-bis(furan-2-yl)-4-methyl-3-propylpiperidin-1-ium-4-ol.
| Compound Name | 2,6-bis(furan-2-yl)-4-methyl-3-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 4921181 |
| Molecular Formula | C17H24NO3+ |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2,6-bis(furan-2-yl)-4-methyl-3-propylpiperidin-1-ium-4-ol |
| SMILES | CCCC1C(c2ccco2)[NH2+]C(c2ccco2)CC1(C)O |
| InChI | InChI=1S/C17H23NO3/c1-3-6-12-16(15-8-5-10-21-15)18-13(11-17(12,2)19)14-7-4-9-20-14/h4-5,7-10,12-13,16,18-19H,3,6,11H2,1-2H3/p+1 |
| InChIKey | KRWCRLSHEPHBQC-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 63.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |