C19H26NO3+ — CID 7560613
(2S,3S,4R,6S)-2,6-bis(furan-2-yl)-4-prop-2-enyl-3-propylpiperidin-1-ium-4-ol (PubChem CID 7560613) has the molecular formula C19H26NO3+ and a molecular weight of 316.42 g/mol. Its IUPAC name is (2S,3S,4R,6S)-2,6-bis(furan-2-yl)-4-prop-2-enyl-3-propylpiperidin-1-ium-4-ol.
| Compound Name | (2S,3S,4R,6S)-2,6-bis(furan-2-yl)-4-prop-2-enyl-3-propylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7560613 |
| Molecular Formula | C19H26NO3+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (2S,3S,4R,6S)-2,6-bis(furan-2-yl)-4-prop-2-enyl-3-propylpiperidin-1-ium-4-ol |
| SMILES | C=CC[C@@]1(O)C[C@@H](c2ccco2)[NH2+][C@H](c2ccco2)[C@@H]1CCC |
| InChI | InChI=1S/C19H25NO3/c1-3-7-14-18(17-9-6-12-23-17)20-15(16-8-5-11-22-16)13-19(14,21)10-4-2/h4-6,8-9,11-12,14-15,18,20-21H,2-3,7,10,13H2,1H3/p+1/t14-,15-,18-,19+/m0/s1 |
| InChIKey | HAJGRIJELRSGMX-STEAMIEHSA-O |
| XLogP | 3.35 |
| TPSA | 63.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|