C19H23N3O2S2 — CID 49217018
[3-(2,3-dimethyl-1H-indole-5-carbonyl)-1,3-thiazolidin-4-yl]-thiomorpholin-4-ylmethanone (PubChem CID 49217018) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is [3-(2,3-dimethyl-1H-indole-5-carbonyl)-1,3-thiazolidin-4-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [3-(2,3-dimethyl-1H-indole-5-carbonyl)-1,3-thiazolidin-4-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 49217018 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [3-(2,3-dimethyl-1H-indole-5-carbonyl)-1,3-thiazolidin-4-yl]-thiomorpholin-4-ylmethanone |
| SMILES | Cc1[nH]c2ccc(C(=O)N3CSCC3C(=O)N3CCSCC3)cc2c1C |
| InChI | InChI=1S/C19H23N3O2S2/c1-12-13(2)20-16-4-3-14(9-15(12)16)18(23)22-11-26-10-17(22)19(24)21-5-7-25-8-6-21/h3-4,9,17,20H,5-8,10-11H2,1-2H3 |
| InChIKey | WWNYLCXFRPTUGP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|