C22H27N3O4S2 — CID 4923335
3-phenylpropyl 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamothioylamino]-5-oxopentanoate (PubChem CID 4923335) has the molecular formula C22H27N3O4S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-phenylpropyl 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923335 |
| Molecular Formula | C22H27N3O4S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-phenylpropyl 5-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamothioylamino]-5-oxopentanoate |
| SMILES | Cc1sc(NC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C22H27N3O4S2/c1-14-15(2)31-21(19(14)20(23)28)25-22(30)24-17(26)11-6-12-18(27)29-13-7-10-16-8-4-3-5-9-16/h3-5,8-9H,6-7,10-13H2,1-2H3,(H2,23,28)(H2,24,25,26,30) |
| InChIKey | HGZXROKZBBLGRJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|