C17H18N2O3S — CID 49309483
3-[(2E)-2-[1-(3-methoxy-4-methylsulfanylphenyl)ethylidene]hydrazinyl]benzoic acid (PubChem CID 49309483) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-[(2E)-2-[1-(3-methoxy-4-methylsulfanylphenyl)ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 3-[(2E)-2-[1-(3-methoxy-4-methylsulfanylphenyl)ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 49309483 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-[(2E)-2-[1-(3-methoxy-4-methylsulfanylphenyl)ethylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cc(/C(C)=N/Nc2cccc(C(=O)O)c2)ccc1SC |
| InChI | InChI=1S/C17H18N2O3S/c1-11(12-7-8-16(23-3)15(10-12)22-2)18-19-14-6-4-5-13(9-14)17(20)21/h4-10,19H,1-3H3,(H,20,21)/b18-11+ |
| InChIKey | FIMYJSBHHFXTMJ-WOJGMQOQSA-N |
| XLogP | 3.95 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|