C19H20Cl2N2O4 — CID 49317060
N'-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]-3,4-dimethoxybenzohydrazide (PubChem CID 49317060) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 49317060 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)-2-methylpropanoyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)C(C)(C)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-19(2,12-6-7-13(20)14(21)10-12)18(25)23-22-17(24)11-5-8-15(26-3)16(9-11)27-4/h5-10H,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | ONYOOWJIJIKENI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|