C20H18Cl2N2O6 — CID 55321283
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 55321283) has the molecular formula C20H18Cl2N2O6 and a molecular weight of 453.28 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55321283 |
| Molecular Formula | C20H18Cl2N2O6 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)/C=C/c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C20H18Cl2N2O6/c1-28-16-7-5-13(10-17(16)29-2)20(27)24-23-18(25)11-30-19(26)8-4-12-3-6-14(21)15(22)9-12/h3-10H,11H2,1-2H3,(H,23,25)(H,24,27)/b8-4+ |
| InChIKey | LLKQHXALSFAGBH-XBXARRHUSA-N |
| XLogP | 3.03 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|