C19H25N3O4S — CID 49318543
(2,4-dimethylphenyl) 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylate (PubChem CID 49318543) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 49318543 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2,4-dimethylphenyl) 1-(1,2-dimethylimidazol-4-yl)sulfonylpiperidine-4-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CCN(S(=O)(=O)c3cn(C)c(C)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-13-5-6-17(14(2)11-13)26-19(23)16-7-9-22(10-8-16)27(24,25)18-12-21(4)15(3)20-18/h5-6,11-12,16H,7-10H2,1-4H3 |
| InChIKey | GOBQMXGIAHHJIZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|