C15H16N4O3S2 — CID 49324210
(E)-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-one (PubChem CID 49324210) has the molecular formula C15H16N4O3S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (E)-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 49324210 |
| Molecular Formula | C15H16N4O3S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (E)-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)-3-(1,3-thiazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cscn1)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C15H16N4O3S2/c20-15(4-3-13-11-23-12-17-13)18-6-8-19(9-7-18)24(21,22)14-2-1-5-16-10-14/h1-5,10-12H,6-9H2/b4-3+ |
| InChIKey | GNXCSFCDTFMFSJ-ONEGZZNKSA-N |
| XLogP | 1.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|