C20H16F2N2OS — CID 49334020
(E)-N-[1,2-bis(3-fluorophenyl)ethyl]-3-(1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 49334020) has the molecular formula C20H16F2N2OS and a molecular weight of 370.42 g/mol. Its IUPAC name is (E)-N-[1,2-bis(3-fluorophenyl)ethyl]-3-(1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[1,2-bis(3-fluorophenyl)ethyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 49334020 |
| Molecular Formula | C20H16F2N2OS |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (E)-N-[1,2-bis(3-fluorophenyl)ethyl]-3-(1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cscn1)NC(Cc1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C20H16F2N2OS/c21-16-5-1-3-14(9-16)10-19(15-4-2-6-17(22)11-15)24-20(25)8-7-18-12-26-13-23-18/h1-9,11-13,19H,10H2,(H,24,25)/b8-7+ |
| InChIKey | OSJAFUKAJJRDGZ-BQYQJAHWSA-N |
| XLogP | 4.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|