C25H33N3O4 — CID 4933799
N-(3,4-dimethylphenyl)-4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobutanamide (PubChem CID 4933799) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 4933799 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[2-(4-hexoxybenzoyl)hydrazinyl]-4-oxobutanamide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)CCC(=O)Nc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C25H33N3O4/c1-4-5-6-7-16-32-22-12-9-20(10-13-22)25(31)28-27-24(30)15-14-23(29)26-21-11-8-18(2)19(3)17-21/h8-13,17H,4-7,14-16H2,1-3H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | NGYBBQBRSZZSQU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|