C18H17F2N3O — CID 49376574
N-[(3,4-difluorophenyl)methyl]-N-ethyl-2-(2H-indazol-3-yl)acetamide (PubChem CID 49376574) has the molecular formula C18H17F2N3O and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N-ethyl-2-(2H-indazol-3-yl)acetamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N-ethyl-2-(2H-indazol-3-yl)acetamide |
|---|---|
| PubChem CID | 49376574 |
| Molecular Formula | C18H17F2N3O |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N-ethyl-2-(2H-indazol-3-yl)acetamide |
| SMILES | CCN(Cc1ccc(F)c(F)c1)C(=O)Cc1[nH]nc2ccccc12 |
| InChI | InChI=1S/C18H17F2N3O/c1-2-23(11-12-7-8-14(19)15(20)9-12)18(24)10-17-13-5-3-4-6-16(13)21-22-17/h3-9H,2,10-11H2,1H3,(H,21,22) |
| InChIKey | BOSUSKRWKDCFNS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |