C17H22F3N3O3 — CID 49401861
1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]-N-propylpiperidine-3-carboxamide (PubChem CID 49401861) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]-N-propylpiperidine-3-carboxamide.
| Compound Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]-N-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 49401861 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[2-[2-oxo-3-(trifluoromethyl)-1-pyridinyl]acetyl]-N-propylpiperidine-3-carboxamide |
| SMILES | CCCNC(=O)C1CCCN(C(=O)Cn2cccc(C(F)(F)F)c2=O)C1 |
| InChI | InChI=1S/C17H22F3N3O3/c1-2-7-21-15(25)12-5-3-8-22(10-12)14(24)11-23-9-4-6-13(16(23)26)17(18,19)20/h4,6,9,12H,2-3,5,7-8,10-11H2,1H3,(H,21,25) |
| InChIKey | SLDMQIGHFYVWSD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |