C17H21ClN4O2 — CID 49487496
1-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide (PubChem CID 49487496) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49487496 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(2-chlorophenyl)-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccn(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H21ClN4O2/c18-14-4-1-2-5-16(14)22-9-6-15(20-22)17(23)19-7-3-8-21-10-12-24-13-11-21/h1-2,4-6,9H,3,7-8,10-13H2,(H,19,23) |
| InChIKey | IOLMCJLOOSZFAF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|