C18H18N2O4 — CID 4971287
6,7,10-trimethyl-3-(5-methyl-1,2-oxazol-3-yl)-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one (PubChem CID 4971287) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 6,7,10-trimethyl-3-(5-methyl-1,2-oxazol-3-yl)-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one.
| Compound Name | 6,7,10-trimethyl-3-(5-methyl-1,2-oxazol-3-yl)-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
|---|---|
| PubChem CID | 4971287 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 6,7,10-trimethyl-3-(5-methyl-1,2-oxazol-3-yl)-2,4-dihydropyrano[3,2-g][1,3]benzoxazin-8-one |
| SMILES | Cc1cc(N2COc3c(cc4c(C)c(C)c(=O)oc4c3C)C2)no1 |
| InChI | InChI=1S/C18H18N2O4/c1-9-5-15(19-24-9)20-7-13-6-14-10(2)11(3)18(21)23-17(14)12(4)16(13)22-8-20/h5-6H,7-8H2,1-4H3 |
| InChIKey | HLFTZQVLWXWDOX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|