C16H14N2O4 — CID 4970332
4-methyl-9-(5-methyl-1,2-oxazol-3-yl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 4970332) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 4-methyl-9-(5-methyl-1,2-oxazol-3-yl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 4-methyl-9-(5-methyl-1,2-oxazol-3-yl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 4970332 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 4-methyl-9-(5-methyl-1,2-oxazol-3-yl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1cc(N2COc3ccc4c(C)cc(=O)oc4c3C2)no1 |
| InChI | InChI=1S/C16H14N2O4/c1-9-5-15(19)21-16-11(9)3-4-13-12(16)7-18(8-20-13)14-6-10(2)22-17-14/h3-6H,7-8H2,1-2H3 |
| InChIKey | ZJTVQNSFOCJNJR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|