C20H18BrNO3 — CID 3785681
9-(3-bromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3785681) has the molecular formula C20H18BrNO3 and a molecular weight of 400.27 g/mol. Its IUPAC name is 9-(3-bromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(3-bromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3785681 |
| Molecular Formula | C20H18BrNO3 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 9-(3-bromophenyl)-4-propyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | CCCc1cc(=O)oc2c3c(ccc12)OCN(c1cccc(Br)c1)C3 |
| InChI | InChI=1S/C20H18BrNO3/c1-2-4-13-9-19(23)25-20-16(13)7-8-18-17(20)11-22(12-24-18)15-6-3-5-14(21)10-15/h3,5-10H,2,4,11-12H2,1H3 |
| InChIKey | INMWMCSMIRAVRJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|